Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals myo-Inositol, 98+%
CAS: 87-89-8 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.156 MDL Number: MFCD00077932 InChI Key: CDAISMWEOUEBRE-UHFFFAOYSA-N Synonym: scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol PubChem CID: 892 ChEBI: CHEBI:24848 IUPAC Name: cyclohexane-1,2,3,4,5,6-hexol SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
| PubChem CID | 892 |
|---|---|
| CAS | 87-89-8 |
| Molecular Weight (g/mol) | 180.156 |
| ChEBI | CHEBI:24848 |
| MDL Number | MFCD00077932 |
| SMILES | C1(C(C(C(C(C1O)O)O)O)O)O |
| Synonym | scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol |
| InChI Key | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| Molecular Formula | C6H12O6 |
N-Allylthiourea, 98%
CAS: 109-57-9 Molecular Formula: C4H8N2S Molecular Weight (g/mol): 116.182 MDL Number: MFCD00004940 InChI Key: HTKFORQRBXIQHD-UHFFFAOYSA-N Synonym: allylthiourea,n-allylthiourea,thiosinamine,1-allyl-2-thiourea,rhodalline,thiosinamin,tiosinamine,1-allylthiourea,aminosin,rhodallin PubChem CID: 1549517 ChEBI: CHEBI:74079 IUPAC Name: prop-2-enylthiourea SMILES: C=CCNC(=S)N
| PubChem CID | 1549517 |
|---|---|
| CAS | 109-57-9 |
| Molecular Weight (g/mol) | 116.182 |
| ChEBI | CHEBI:74079 |
| MDL Number | MFCD00004940 |
| SMILES | C=CCNC(=S)N |
| Synonym | allylthiourea,n-allylthiourea,thiosinamine,1-allyl-2-thiourea,rhodalline,thiosinamin,tiosinamine,1-allylthiourea,aminosin,rhodallin |
| IUPAC Name | prop-2-enylthiourea |
| InChI Key | HTKFORQRBXIQHD-UHFFFAOYSA-N |
| Molecular Formula | C4H8N2S |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.154 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.154 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |
Thermo Scientific Chemicals D-Fructose-6-phosphate disodium salt, 95%
CAS: 26177-86-6 Molecular Formula: C6H13Na2O9P Molecular Weight (g/mol): 306.11 MDL Number: MFCD16661244 InChI Key: VAPLWAFNCWDFQF-UHFFFAOYNA-N PubChem CID: 129893509 IUPAC Name: sodium;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate SMILES: [Na].[Na].OCC(=O)C(O)C(O)C(O)COP(O)(O)=O
| PubChem CID | 129893509 |
|---|---|
| CAS | 26177-86-6 |
| Molecular Weight (g/mol) | 306.11 |
| MDL Number | MFCD16661244 |
| SMILES | [Na].[Na].OCC(=O)C(O)C(O)C(O)COP(O)(O)=O |
| IUPAC Name | sodium;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate |
| InChI Key | VAPLWAFNCWDFQF-UHFFFAOYNA-N |
| Molecular Formula | C6H13Na2O9P |
Iodoethane, 98+%, stab. with copper
CAS: 75-03-6 Molecular Formula: C2H5I Molecular Weight (g/mol): 155.966 MDL Number: MFCD00001091 InChI Key: HVTICUPFWKNHNG-UHFFFAOYSA-N Synonym: ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech PubChem CID: 6340 ChEBI: CHEBI:42487 IUPAC Name: iodoethane SMILES: CCI
| PubChem CID | 6340 |
|---|---|
| CAS | 75-03-6 |
| Molecular Weight (g/mol) | 155.966 |
| ChEBI | CHEBI:42487 |
| MDL Number | MFCD00001091 |
| SMILES | CCI |
| Synonym | ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech |
| IUPAC Name | iodoethane |
| InChI Key | HVTICUPFWKNHNG-UHFFFAOYSA-N |
| Molecular Formula | C2H5I |
Aniline, 99.5%, extra pure
CAS: 62-53-3 Molecular Formula: C6H7N Molecular Weight (g/mol): 93.13 MDL Number: MFCD00007629 InChI Key: PAYRUJLWNCNPSJ-UHFFFAOYSA-N Synonym: benzenamine,phenylamine,aminobenzene,aminophen,anilin,kyanol,arylamine,cyanol,benzeneamine,benzidam PubChem CID: 6115 ChEBI: CHEBI:17296 IUPAC Name: aniline SMILES: NC1=CC=CC=C1
| PubChem CID | 6115 |
|---|---|
| CAS | 62-53-3 |
| Molecular Weight (g/mol) | 93.13 |
| ChEBI | CHEBI:17296 |
| MDL Number | MFCD00007629 |
| SMILES | NC1=CC=CC=C1 |
| Synonym | benzenamine,phenylamine,aminobenzene,aminophen,anilin,kyanol,arylamine,cyanol,benzeneamine,benzidam |
| IUPAC Name | aniline |
| InChI Key | PAYRUJLWNCNPSJ-UHFFFAOYSA-N |
| Molecular Formula | C6H7N |
L(+)-Ascorbyl palmitate, specified according to requirements of USP/Ph.Eur., Thermo Scientific Chemicals
CAS: 137-66-6 Molecular Formula: C22H38O7 Molecular Weight (g/mol): 414.54 MDL Number: MFCD00005377 InChI Key: NULLRXHRYOXSEW-UHFFFAOYNA-N Synonym: ascorbyl palmitate,l-ascorbyl 6-palmitate,6-o-palmitoyl-l-ascorbic acid,ascorbic palmitate,l-ascorbyl palmitate,unii-qn83us2b0n,ascorbyl monopalmitate,l-ascorbic acid 6-palmitate,s-2-r-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl-2-hydroxyethyl palmitate,ascorbyl palmitate nf PubChem CID: 54680660 IUPAC Name: [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC(O)C1OC(O)=C(O)C1=O
| PubChem CID | 54680660 |
|---|---|
| CAS | 137-66-6 |
| Molecular Weight (g/mol) | 414.54 |
| MDL Number | MFCD00005377 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(O)C1OC(O)=C(O)C1=O |
| Synonym | ascorbyl palmitate,l-ascorbyl 6-palmitate,6-o-palmitoyl-l-ascorbic acid,ascorbic palmitate,l-ascorbyl palmitate,unii-qn83us2b0n,ascorbyl monopalmitate,l-ascorbic acid 6-palmitate,s-2-r-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl-2-hydroxyethyl palmitate,ascorbyl palmitate nf |
| IUPAC Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] hexadecanoate |
| InChI Key | NULLRXHRYOXSEW-UHFFFAOYNA-N |
| Molecular Formula | C22H38O7 |
Dansyl chloride, 96%
CAS: 605-65-2 Molecular Formula: C12H12ClNO2S Molecular Weight (g/mol): 269.74 MDL Number: MFCD00003985 InChI Key: XPDXVDYUQZHFPV-UHFFFAOYSA-N Synonym: dansyl chloride,5-dimethylamino naphthalene-1-sulfonyl chloride,dns chloride,dansyl,5-dimethylamino-1-naphthalenesulfonyl chloride,1-naphthalenesulfonyl chloride, 5-dimethylamino,1-dimethylaminonaphthalene-5-sulfonyl chloride,1-chlorosulfonyl-5-dimethylaminonaphthalene,unii-qmu9166tj4,5-dimethylaminonaphthalene-1-sulphonyl chloride PubChem CID: 11801 ChEBI: CHEBI:51907 IUPAC Name: 5-(dimethylamino)naphthalene-1-sulfonyl chloride SMILES: CN(C)C1=CC=CC2=C(C=CC=C12)S(Cl)(=O)=O
| PubChem CID | 11801 |
|---|---|
| CAS | 605-65-2 |
| Molecular Weight (g/mol) | 269.74 |
| ChEBI | CHEBI:51907 |
| MDL Number | MFCD00003985 |
| SMILES | CN(C)C1=CC=CC2=C(C=CC=C12)S(Cl)(=O)=O |
| Synonym | dansyl chloride,5-dimethylamino naphthalene-1-sulfonyl chloride,dns chloride,dansyl,5-dimethylamino-1-naphthalenesulfonyl chloride,1-naphthalenesulfonyl chloride, 5-dimethylamino,1-dimethylaminonaphthalene-5-sulfonyl chloride,1-chlorosulfonyl-5-dimethylaminonaphthalene,unii-qmu9166tj4,5-dimethylaminonaphthalene-1-sulphonyl chloride |
| IUPAC Name | 5-(dimethylamino)naphthalene-1-sulfonyl chloride |
| InChI Key | XPDXVDYUQZHFPV-UHFFFAOYSA-N |
| Molecular Formula | C12H12ClNO2S |
3-(3,4-Dihydroxyphenyl)-L-alanine 98.0+%, TCI America™
CAS: 59-92-7 Molecular Formula: C9H11NO4 Molecular Weight (g/mol): 197.19 MDL Number: MFCD00002598 InChI Key: WTDRDQBEARUVNC-LURJTMIESA-N Synonym: levodopa,l-dopa,dopar,3-hydroxy-l-tyrosine,3,4-dihydroxy-l-phenylalanine,larodopa,bendopa,levopa,dihydroxy-l-phenylalanine,cidandopa PubChem CID: 6047 ChEBI: CHEBI:15765 IUPAC Name: (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid SMILES: N[C@@H](CC1=CC=C(O)C(O)=C1)C(O)=O
| PubChem CID | 6047 |
|---|---|
| CAS | 59-92-7 |
| Molecular Weight (g/mol) | 197.19 |
| ChEBI | CHEBI:15765 |
| MDL Number | MFCD00002598 |
| SMILES | N[C@@H](CC1=CC=C(O)C(O)=C1)C(O)=O |
| Synonym | levodopa,l-dopa,dopar,3-hydroxy-l-tyrosine,3,4-dihydroxy-l-phenylalanine,larodopa,bendopa,levopa,dihydroxy-l-phenylalanine,cidandopa |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| InChI Key | WTDRDQBEARUVNC-LURJTMIESA-N |
| Molecular Formula | C9H11NO4 |
Diphenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.211 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.211 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Sodium n-octyl sulfate, 99%
CAS: 142-31-4 Molecular Formula: C8H17NaO4S Molecular Weight (g/mol): 232.27 MDL Number: MFCD00007470 InChI Key: WFRKJMRGXGWHBM-UHFFFAOYSA-M Synonym: sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt PubChem CID: 2735107 IUPAC Name: sodium;octyl sulfate SMILES: CCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 2735107 |
|---|---|
| CAS | 142-31-4 |
| Molecular Weight (g/mol) | 232.27 |
| MDL Number | MFCD00007470 |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt |
| IUPAC Name | sodium;octyl sulfate |
| InChI Key | WFRKJMRGXGWHBM-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO4S |
Aurintricarboxylic acid
CAS: 4431-00-9 Molecular Formula: C22H16O9 Molecular Weight (g/mol): 424.36 MDL Number: MFCD00011663 InChI Key: YETAHXYTPZCNBG-UHFFFAOYNA-N Synonym: aurintricarboxylic acid,aluminon free acid,aluminon,5,5'-3-carboxy-4-oxocyclohexa-2,5-dienylidenemethylene di salicylic acid,benzoic acid, 5-3-carboxy-4-hydroxyphenyl 3-carboxy-4-oxo-2,5-cyclohexadien-1-ylidene methyl-2-hydroxy,1,4-cyclohexadiene-1-carboxylic acid, 3-bis 3-carboxy-4-hydroxyphenyl methylene-6-oxo,3,3'-3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene methylene bis 6-hydroxybenzoic acid,5,5'-3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene methylene bis 2-hydroxybenzoic acid PubChem CID: 2259 ChEBI: CHEBI:87397 IUPAC Name: 5-[(3-carboxy-4-hydroxyphenyl)(3-carboxy-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-hydroxybenzoic acid SMILES: OC(=O)C1=CC(C=CC1=O)C(C1=CC=C(O)C(=C1)C(O)=O)C1=CC=C(O)C(=C1)C(O)=O
| PubChem CID | 2259 |
|---|---|
| CAS | 4431-00-9 |
| Molecular Weight (g/mol) | 424.36 |
| ChEBI | CHEBI:87397 |
| MDL Number | MFCD00011663 |
| SMILES | OC(=O)C1=CC(C=CC1=O)C(C1=CC=C(O)C(=C1)C(O)=O)C1=CC=C(O)C(=C1)C(O)=O |
| Synonym | aurintricarboxylic acid,aluminon free acid,aluminon,5,5'-3-carboxy-4-oxocyclohexa-2,5-dienylidenemethylene di salicylic acid,benzoic acid, 5-3-carboxy-4-hydroxyphenyl 3-carboxy-4-oxo-2,5-cyclohexadien-1-ylidene methyl-2-hydroxy,1,4-cyclohexadiene-1-carboxylic acid, 3-bis 3-carboxy-4-hydroxyphenyl methylene-6-oxo,3,3'-3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene methylene bis 6-hydroxybenzoic acid,5,5'-3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene methylene bis 2-hydroxybenzoic acid |
| IUPAC Name | 5-[(3-carboxy-4-hydroxyphenyl)(3-carboxy-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-hydroxybenzoic acid |
| InChI Key | YETAHXYTPZCNBG-UHFFFAOYNA-N |
| Molecular Formula | C22H16O9 |
1-Dodecylamine, 97%
CAS: 124-22-1 Molecular Formula: C12H27N Molecular Weight (g/mol): 185.36 MDL Number: MFCD00008154 InChI Key: JRBPAEWTRLWTQC-UHFFFAOYSA-N Synonym: dodecylamine,1-dodecanamine,laurylamine,1-aminododecane,n-dodecylamine,dodecanamine,1-dodecylamine,lauramine,n-laurylamine,alamine 4 PubChem CID: 13583 IUPAC Name: dodecan-1-amine SMILES: CCCCCCCCCCCCN
| PubChem CID | 13583 |
|---|---|
| CAS | 124-22-1 |
| Molecular Weight (g/mol) | 185.36 |
| MDL Number | MFCD00008154 |
| SMILES | CCCCCCCCCCCCN |
| Synonym | dodecylamine,1-dodecanamine,laurylamine,1-aminododecane,n-dodecylamine,dodecanamine,1-dodecylamine,lauramine,n-laurylamine,alamine 4 |
| IUPAC Name | dodecan-1-amine |
| InChI Key | JRBPAEWTRLWTQC-UHFFFAOYSA-N |
| Molecular Formula | C12H27N |
Bis(1,5-cyclooctadiene)nickel(0)
CAS: 1295-35-8 Molecular Formula: C16H24Ni Molecular Weight (g/mol): 275.06 MDL Number: MFCD00058902 InChI Key: JRTIUDXYIUKIIE-KZUMESAESA-N Synonym: bis 1,5-cyclooctadiene nickel 0,bis 1,5-cyclooctadiene nickel,ni cod 2,ccris 5973,bis cyclooctadiene nickel 0,nickel, bis 1,5-cyclooctadiene,bis cyclooctadiene nickel,1z,5z-cycloocta-1,5-diene; nickel,nickel biscod,pubchem16018 PubChem CID: 6433264 SMILES: [Ni].C1C\C=C/CC\C=C/1.C1C\C=C/CC\C=C/1
| PubChem CID | 6433264 |
|---|---|
| CAS | 1295-35-8 |
| Molecular Weight (g/mol) | 275.06 |
| MDL Number | MFCD00058902 |
| SMILES | [Ni].C1C\C=C/CC\C=C/1.C1C\C=C/CC\C=C/1 |
| Synonym | bis 1,5-cyclooctadiene nickel 0,bis 1,5-cyclooctadiene nickel,ni cod 2,ccris 5973,bis cyclooctadiene nickel 0,nickel, bis 1,5-cyclooctadiene,bis cyclooctadiene nickel,1z,5z-cycloocta-1,5-diene; nickel,nickel biscod,pubchem16018 |
| InChI Key | JRTIUDXYIUKIIE-KZUMESAESA-N |
| Molecular Formula | C16H24Ni |